Products 1337606-76-4
CAS 1337606-76-4 appears in our catalog under these names: Methyl 4–(bromomethyl)–2，6–difluorobenzoate, Methyl 4-(Bromomethyl)-2,6-difluorobenzoate, Methyl 4-(bromomethyl)-2,6-difluorobenzoate, 95%, Methyl 4-(Bromomethyl)-2,6-difluorobenzoate, 95%, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 250mg.
Methyl 4-(bromomethyl)-2,6-difluorobenzoate (CAS 1337606-76-4) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 4-(bromomethyl)-2,6-difluorobenzoate. InChIKey: BFEKOTUJVAIWPK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 4-(bromomethyl)-2,6-difluorobenzoate |
| InChIKey | BFEKOTUJVAIWPK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)CBr)F |
Computed by PubChem (NCBI)