CAS 77055-30-2 appears in our catalog under these names: 5-(tert-Butyl)-2-methoxy-1,3-dinitrobenzene, 98%, 4-tert-Butyl-2,6-dinitroanisole, 5-(1,1-Dimethylethyl)-2-methoxy-1,3-dinitrobenzene, 98%, 98%. Offered by: Fluorochem, Biosynth, Chemat. Available pack sizes: 5g, 25g, 10g, 50g, 100g.
5-tert-butyl-2-methoxy-1,3-dinitrobenzene (CAS 77055-30-2) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: 5-tert-butyl-2-methoxy-1,3-dinitrobenzene. InChIKey: OPKICKIJGJZVTG-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-tert-butyl-2-methoxy-1,3-dinitrobenzene |
| InChIKey | OPKICKIJGJZVTG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)[N+](=O)[O-])OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)