CAS 1338986-16-5 is the registry number for 5-Bromo-2-(3-methyl-1H-1,2,4-triazol-5-yl)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine (CAS 1338986-16-5) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine. InChIKey: JXIMENQPNOTKHN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine |
| InChIKey | JXIMENQPNOTKHN-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)