CAS 1339509-57-7 is the registry number for 6-Fluoro-8-methyl-2,4-dihydro-1H-3,1-benzoxazine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-fluoro-8-methyl-1H-3,1-benzoxazine-2,4-dione (CAS 1339509-57-7) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 6-fluoro-8-methyl-1H-3,1-benzoxazine-2,4-dione. InChIKey: HFYAVHMLOZWPPU-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 6-fluoro-8-methyl-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | HFYAVHMLOZWPPU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)OC2=O)F |
Computed by PubChem (NCBI)