CAS 1343659-96-0 appears in our catalog under these names: 2,4,6-Trimethoxybenzene-1-sulfonamide, 95%, 2,4,6-Trimethoxybenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4,6-trimethoxybenzenesulfonamide (CAS 1343659-96-0) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. IUPAC name: 2,4,6-trimethoxybenzenesulfonamide. InChIKey: PXVUDLXXKGSXHH-UHFFFAOYSA-N.
| Molecular formula | C9H13NO5S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2,4,6-trimethoxybenzenesulfonamide |
| InChIKey | PXVUDLXXKGSXHH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)S(=O)(=O)N)OC |
Computed by PubChem (NCBI)