CAS 64741-34-0 is the registry number for 3,4,5-Trimethoxybenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,4,5-trimethoxybenzenesulfonamide (CAS 64741-34-0) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. IUPAC name: 3,4,5-trimethoxybenzenesulfonamide. InChIKey: MJAHNNKQLXJQDX-UHFFFAOYSA-N.
| Molecular formula | C9H13NO5S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 3,4,5-trimethoxybenzenesulfonamide |
| InChIKey | MJAHNNKQLXJQDX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)S(=O)(=O)N |
Computed by PubChem (NCBI)