CAS 78995-75-2 appears in our catalog under these names: (1R)-1-(3,4-Dihydroxyphenyl)-2-(methylamino)ethanesulfonic acid, Adrenaline Tartrate Impurity F, Adrenaline Impurity F, Adrenaline Impurity 6(Adrenaline EP Impurity F), (1R)-1-(3,4-Dihydroxyphenyl)-2-methylaminoethanesulphonic Acid (Adrenaline beta-Sulphonate). Offered by: Biosynth, Chemat Brand, Hubei YoungXin, Mikromol, Chemat. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg, on request, 50mg, 100mg.
(1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanesulfonic acid (CAS 78995-75-2) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. IUPAC name: (1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanesulfonic acid. InChIKey: TYYGQMPOZGEFQL-VIFPVBQESA-N.
| Molecular formula | C9H13NO5S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | (1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanesulfonic acid |
| InChIKey | TYYGQMPOZGEFQL-VIFPVBQESA-N |
| SMILES | CNC[C@@H](C1=CC(=C(C=C1)O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)