Products 1346604-55-4
CAS 1346604-55-4 appears in our catalog under these names: Epinephrine Sulfonic Acid-d3, >95% (HPLC), Epinephrine sulfonic acid-d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 50mg, 25mg, 1 mg, 10 mg.
1-(3,4-dihydroxyphenyl)-2-(trideuteriomethylamino)ethanesulfonic acid (CAS 1346604-55-4) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 250.29 g/mol. IUPAC name: 1-(3,4-dihydroxyphenyl)-2-(trideuteriomethylamino)ethanesulfonic acid. InChIKey: TYYGQMPOZGEFQL-FIBGUPNXSA-N.
| Molecular formula | C9H13NO5S |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 1-(3,4-dihydroxyphenyl)-2-(trideuteriomethylamino)ethanesulfonic acid |
| InChIKey | TYYGQMPOZGEFQL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C1=CC(=C(C=C1)O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)