Products 2727323-57-9

CAS 2727323-57-9 is the registry number for Glycine-13C2,15N p-Toluenesulfonate. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

2-(15N)azanylacetic acid;4-methylbenzenesulfonic acid (CAS 2727323-57-9) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 250.25 g/mol. IUPAC name: 2-(15N)azanylacetic acid;4-methylbenzenesulfonic acid. InChIKey: REKJMSPJAIXEQJ-BURVIEGVSA-N.

Identity
Molecular formulaC9H13NO5S
Molecular weight250.25 g/mol
IUPAC name2-(15N)azanylacetic acid;4-methylbenzenesulfonic acid
InChIKeyREKJMSPJAIXEQJ-BURVIEGVSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.[13CH2]([13C](=O)O)[15NH2]

Computed by PubChem (NCBI)