CAS 2727323-57-9 is the registry number for Glycine-13C2,15N p-Toluenesulfonate. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 5 mg, 10 mg.
2-(15N)azanylacetic acid;4-methylbenzenesulfonic acid (CAS 2727323-57-9) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 250.25 g/mol. IUPAC name: 2-(15N)azanylacetic acid;4-methylbenzenesulfonic acid. InChIKey: REKJMSPJAIXEQJ-BURVIEGVSA-N.
| Molecular formula | C9H13NO5S |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 2-(15N)azanylacetic acid;4-methylbenzenesulfonic acid |
| InChIKey | REKJMSPJAIXEQJ-BURVIEGVSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.[13CH2]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)