CAS 860514-43-8 appears in our catalog under these names: 2,3,4-Trimethoxybenzene-1-sulfonamide, 95%, 2,3,4-Trimethoxybenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2,3,4-trimethoxybenzenesulfonamide (CAS 860514-43-8) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. IUPAC name: 2,3,4-trimethoxybenzenesulfonamide. InChIKey: GOPREVNNVUSFEB-UHFFFAOYSA-N.
| Molecular formula | C9H13NO5S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2,3,4-trimethoxybenzenesulfonamide |
| InChIKey | GOPREVNNVUSFEB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)S(=O)(=O)N)OC)OC |
Computed by PubChem (NCBI)