CAS 716361-62-5 is the registry number for 4-(N,N-Dimethylsulfamoyl)-2,5-dimethylfuran-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(dimethylsulfamoyl)-2,5-dimethylfuran-3-carboxylic acid (CAS 716361-62-5) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. IUPAC name: 4-(dimethylsulfamoyl)-2,5-dimethylfuran-3-carboxylic acid. InChIKey: MJNZOQYJGMIVAE-UHFFFAOYSA-N.
| Molecular formula | C9H13NO5S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 4-(dimethylsulfamoyl)-2,5-dimethylfuran-3-carboxylic acid |
| InChIKey | MJNZOQYJGMIVAE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(O1)C)S(=O)(=O)N(C)C)C(=O)O |
Computed by PubChem (NCBI)