Products 2891513-63-4

CAS 2891513-63-4 is the registry number for 5-(3-Methoxypropoxy)pyridine-3-sulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(3-methoxypropoxy)pyridine-3-sulfonic acid (CAS 2891513-63-4) is a chemical compound with the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. IUPAC name: 5-(3-methoxypropoxy)pyridine-3-sulfonic acid. InChIKey: PQLZWKOTEWOSKG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO5S
Molecular weight247.27 g/mol
IUPAC name5-(3-methoxypropoxy)pyridine-3-sulfonic acid
InChIKeyPQLZWKOTEWOSKG-UHFFFAOYSA-N
SMILESCOCCCOC1=CC(=CN=C1)S(=O)(=O)O

Computed by PubChem (NCBI)