Products 1343702-03-3
CAS 1343702-03-3 is the registry number for Methyl 5-amino-2,3-dichlorobenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5-amino-2,3-dichlorobenzoate (CAS 1343702-03-3) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 5-amino-2,3-dichlorobenzoate. InChIKey: JEWUMKBIZFDWSI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 5-amino-2,3-dichlorobenzoate |
| InChIKey | JEWUMKBIZFDWSI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)N)Cl)Cl |
Computed by PubChem (NCBI)