Products 1346146-39-1
CAS 1346146-39-1 is the registry number for 1-(3-bromophenyl)-3-oxabicyclo[3.1.0]hexan-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-(3-bromophenyl)-3-oxabicyclo[3.1.0]hexan-2-one (CAS 1346146-39-1) is a chemical compound with the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. IUPAC name: 1-(3-bromophenyl)-3-oxabicyclo[3.1.0]hexan-2-one. InChIKey: GZTCRGYVERKPJJ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3-oxabicyclo[3.1.0]hexan-2-one |
| InChIKey | GZTCRGYVERKPJJ-UHFFFAOYSA-N |
| SMILES | C1C2C1(C(=O)OC2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)