CAS 1346154-86-6 is the registry number for rac-Mono-(4-methyloctanyl)-phthalate-D4. Offered by: TRC. Available pack sizes: 10mg.
2,3,4,5-tetradeuterio-6-(4-methyloctoxycarbonyl)benzoic acid (CAS 1346154-86-6) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 296.39 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(4-methyloctoxycarbonyl)benzoic acid. InChIKey: XEYQNGJVRAQJAW-SOBLDAANSA-N.
| Molecular formula | C17H24O4 |
|---|---|
| Molecular weight | 296.39 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(4-methyloctoxycarbonyl)benzoic acid |
| InChIKey | XEYQNGJVRAQJAW-SOBLDAANSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCC(C)CCCC)[2H])[2H] |
Computed by PubChem (NCBI)