Products 1347853-72-8
CAS 1347853-72-8 is the registry number for 1-Acetylpiperidine-4-carboxylic acid Hydrochloride. Offered by: Chemat. Available pack sizes: 5g.
1-acetylpiperidine-4-carboxylic acid;hydrochloride (CAS 1347853-72-8) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: 1-acetylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: AXPKWCUZNAUEMI-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 1-acetylpiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | AXPKWCUZNAUEMI-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(CC1)C(=O)O.Cl |
Computed by PubChem (NCBI)