CAS 134792-45-3 is the registry number for 6-Fluoro-2H-benzo(e)(1,3)oxazine-2,4(3H)-dione, 98%. Offered by: AmBeed. Available pack sizes: 5g.
6-fluoro-1,3-benzoxazine-2,4-dione (CAS 134792-45-3) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 6-fluoro-1,3-benzoxazine-2,4-dione. InChIKey: SLGAPWSWRLDIMS-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 6-fluoro-1,3-benzoxazine-2,4-dione |
| InChIKey | SLGAPWSWRLDIMS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)NC(=O)O2 |
Computed by PubChem (NCBI)