CAS 174463-53-7 appears in our catalog under these names: 8-Fluoro-1H-benzo[d][1,3]oxazine-2,4-dione, 97%, 97%, 3-Fluoroisatoic anhydride, 97%, 8-Fluoro-1H-benzo[d][1,3]oxazine-2,4-dione, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
8-fluoro-1H-3,1-benzoxazine-2,4-dione (CAS 174463-53-7) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 8-fluoro-1H-3,1-benzoxazine-2,4-dione. InChIKey: IERJBARKMJORGI-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 8-fluoro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | IERJBARKMJORGI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)NC(=O)OC2=O |
Computed by PubChem (NCBI)