CAS 1779971-18-4 is the registry number for 7-Fluorobenzo[c]isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-fluoro-2,1-benzoxazole-3-carboxylic acid (CAS 1779971-18-4) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 7-fluoro-2,1-benzoxazole-3-carboxylic acid. InChIKey: RZNYRPFBFCJZFM-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 7-fluoro-2,1-benzoxazole-3-carboxylic acid |
| InChIKey | RZNYRPFBFCJZFM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(ON=C2C(=C1)F)C(=O)O |
Computed by PubChem (NCBI)