Products 944898-49-1
CAS 944898-49-1 appears in our catalog under these names: 5-Fluoro-1,3-benzoxazole-2-carboxylic acid, 5-Fluorobenzo[d]oxazole-2-carboxylic acid, 98%, 98%, 5-Fluoro-benzooxazole-2-carboxylic acid, 95%, 5-Fluorobenzo[d]oxazole-2-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,025g, 100mg, 1g, 250mg, 5g.
5-fluoro-1,3-benzoxazole-2-carboxylic acid (CAS 944898-49-1) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 5-fluoro-1,3-benzoxazole-2-carboxylic acid. InChIKey: IVWRUQHCOXUMAX-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 5-fluoro-1,3-benzoxazole-2-carboxylic acid |
| InChIKey | IVWRUQHCOXUMAX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N=C(O2)C(=O)O |
Computed by PubChem (NCBI)