Products 321-69-7
CAS 321-69-7 appears in our catalog under these names: 5-Fluoroisatoic Anhydride, 5–Fluoroisatoic anhydride, 5-Fluoroisatoic anhydride, 96%, 6-Fluoro-2H-benzo[d][1,3]oxazine-2,4(1H)-dione, 97%. Offered by: TRC, GLPBio, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 25g, 5g, 10g, 100g, 1g.
6-fluoro-1H-3,1-benzoxazine-2,4-dione (CAS 321-69-7) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 6-fluoro-1H-3,1-benzoxazine-2,4-dione. InChIKey: UBKGOWGNYKVYEF-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 6-fluoro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | UBKGOWGNYKVYEF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
5-Fluoroisatoic anhydride, 6-fluoro-1H-benzo[d][1,3]oxazine-2,4-dione, 5-Fluoroisatonic anhydride, 6-fluoro-1H-3,1-benzoxazine-2,4-dione, 6-fluoro-2H-3,1-benzoxazine-2,4(1H)-dione, 6-fluoro-2H-benzo[d][1,3]oxazine-2,4(1H)-dione, Flumazenil Impurity 15, 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-fluoro-, 5-fluoroisatoic acid anhydride, 5-fluoro-isatoic acid anhydride