CAS 321-50-6 appears in our catalog under these names: 7-Fluoro-1H-benzo[d][1,3]oxazine-2,4-dione, 97%, 97%, 4-Fluoroisatoic anhydride, 97%, 7-Fluoro-1H-benzo[d][1,3]oxazine-2,4-dione, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g.
7-fluoro-1H-3,1-benzoxazine-2,4-dione (CAS 321-50-6) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 7-fluoro-1H-3,1-benzoxazine-2,4-dione. InChIKey: JEVWCMDHSLNNDR-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 7-fluoro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | JEVWCMDHSLNNDR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)OC2=O |
Computed by PubChem (NCBI)