Products 1360927-50-9
CAS 1360927-50-9 is the registry number for 7-Fluoro-6-hydroxy-2,3-dihydro-1H-indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-fluoro-6-hydroxy-1H-indole-2,3-dione (CAS 1360927-50-9) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 7-fluoro-6-hydroxy-1H-indole-2,3-dione. InChIKey: NZWGSVLTJXVDDQ-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 7-fluoro-6-hydroxy-1H-indole-2,3-dione |
| InChIKey | NZWGSVLTJXVDDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)F)O |
Computed by PubChem (NCBI)