Products 894789-50-5
CAS 894789-50-5 appears in our catalog under these names: 5-Fluoro-1,2-benzoxazole-3-carboxylic acid, 5-Fluoro-1,2-benzoxazole-3-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
5-fluoro-1,2-benzoxazole-3-carboxylic acid (CAS 894789-50-5) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 5-fluoro-1,2-benzoxazole-3-carboxylic acid. InChIKey: UVIKIZJWOLGNSL-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 5-fluoro-1,2-benzoxazole-3-carboxylic acid |
| InChIKey | UVIKIZJWOLGNSL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=NO2)C(=O)O |
Computed by PubChem (NCBI)