Products 1351416-48-2

CAS 1351416-48-2 is the registry number for 2-Ethyl-5-methoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethyl-5-methoxybenzenesulfonyl chloride (CAS 1351416-48-2) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 2-ethyl-5-methoxybenzenesulfonyl chloride. InChIKey: QAHUTUQKUYGTOR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO3S
Molecular weight234.70 g/mol
IUPAC name2-ethyl-5-methoxybenzenesulfonyl chloride
InChIKeyQAHUTUQKUYGTOR-UHFFFAOYSA-N
SMILESCCC1=C(C=C(C=C1)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)