CAS 1352707-91-5 appears in our catalog under these names: 8-Bromo-2,3,4,5-tetrahydro-1,4-benzoxazepine hydrochloride, 95%, 8-Bromo-2,3,4,5-tetrahydro-1,4-benzoxazepine hydrochloride, 8-Bromo-2,3,4,5-tetrahydro-1,4-benzoxazepine hydrochloride, 95%, 95%, 8-Bromo-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine hydrochloride, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 100mg, 250mg.
8-bromo-2,3,4,5-tetrahydro-1,4-benzoxazepine;hydrochloride (CAS 1352707-91-5) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: 8-bromo-2,3,4,5-tetrahydro-1,4-benzoxazepine;hydrochloride. InChIKey: TXPKPBMYEYKMHU-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | 8-bromo-2,3,4,5-tetrahydro-1,4-benzoxazepine;hydrochloride |
| InChIKey | TXPKPBMYEYKMHU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(CN1)C=CC(=C2)Br.Cl |
Computed by PubChem (NCBI)