CAS 1354951-34-0 is the registry number for 2-(2,3-Difluorophenyl)cyclopropanamine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
2-(2,3-difluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1354951-34-0) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 2-(2,3-difluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: APPPWEDMBMWHEM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 2-(2,3-difluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | APPPWEDMBMWHEM-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=C(C(=CC=C2)F)F.Cl |
Computed by PubChem (NCBI)