Products 1356114-12-9
CAS 1356114-12-9 is the registry number for 2-Bromo-1,3-dimethyl-5-(trifluoromethyl)benzene, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
2-bromo-1,3-dimethyl-5-(trifluoromethyl)benzene (CAS 1356114-12-9) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 2-bromo-1,3-dimethyl-5-(trifluoromethyl)benzene. InChIKey: LBUQCIBXTGQNIQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 2-bromo-1,3-dimethyl-5-(trifluoromethyl)benzene |
| InChIKey | LBUQCIBXTGQNIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C(F)(F)F |
Computed by PubChem (NCBI)