Products 1357087-30-9
CAS 1357087-30-9 appears in our catalog under these names: 5,7-Dichloro-2-methyl-2h-pyrazolo[4,3-d]pyrimidine, 95%, 5,7-Dichloro-2-methyl-2H-pyrazolo(4,3-d)pyrimidine, 97%, 5,7-Dichloro-2-methyl-2H-pyrazolo[4,3-d]pyrimidine, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 25g, 100mg, 500mg, 5g, 10g.
5,7-dichloro-2-methylpyrazolo[4,3-d]pyrimidine (CAS 1357087-30-9) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 5,7-dichloro-2-methylpyrazolo[4,3-d]pyrimidine. InChIKey: PLFZXMBGZDYSSV-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 5,7-dichloro-2-methylpyrazolo[4,3-d]pyrimidine |
| InChIKey | PLFZXMBGZDYSSV-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)