CAS 57476-37-6 appears in our catalog under these names: 2,6-Dichloro-8-methyl-9h-purine, 95%, 2,6-Dichloro-8-methyl-9H-purine 98%, 2,6-Dichloro-8-methyl-9H-purine, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 25g, 10g.
2,6-dichloro-8-methyl-7H-purine (CAS 57476-37-6) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 2,6-dichloro-8-methyl-7H-purine. InChIKey: OKYAPKJJKHBWIO-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 2,6-dichloro-8-methyl-7H-purine |
| InChIKey | OKYAPKJJKHBWIO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)