CAS 89281-22-1 appears in our catalog under these names: 5,7-Dichloro-6-methyl-(1,2,4)triazolo(1,5-a)pyrimidine, 95%, 5,7-Dichloro-6-methyl-(1,2,4)triazolo(1,5-a)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5,7-dichloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 89281-22-1) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 5,7-dichloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: YGIKKMZWXWEZNM-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 5,7-dichloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | YGIKKMZWXWEZNM-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=NC=N2)N=C1Cl)Cl |
Computed by PubChem (NCBI)