Products 959432-77-0
CAS 959432-77-0 appears in our catalog under these names: 4,6-Dichloro-2-methyl-2H-pyrazolo(3,4-d)pyrimidine, 4,6-Dichloro-2-methyl-2H-pyrazolo[3,4-d]pyrimidine 97%, 4,6-Dichloro-2-methyl-2h-pyrazolo[3,4-d]pyrimidine, 97%, 97%, 4,6-Dichloro-2-methyl-2h-pyrazolo[3,4-d]pyrimidine, 95+%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 750mg, 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 500mg.
4,6-dichloro-2-methylpyrazolo[3,4-d]pyrimidine (CAS 959432-77-0) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 4,6-dichloro-2-methylpyrazolo[3,4-d]pyrimidine. InChIKey: QLHBOALBAOKBJV-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 4,6-dichloro-2-methylpyrazolo[3,4-d]pyrimidine |
| InChIKey | QLHBOALBAOKBJV-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=N1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)