Products 1211522-68-7
CAS 1211522-68-7 is the registry number for 4,6-Dichloro-3-methyl-1H-pyrazolo[3,4-d]pyrimidine, 97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25mg, 500mg.
4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine (CAS 1211522-68-7) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine. InChIKey: WAVYWHRLGFPXMJ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine |
| InChIKey | WAVYWHRLGFPXMJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)