CAS 2645374-13-4 is the registry number for 4,7-Dichloro-2-methyl-2H-pyrazolo[3,4-d]pyridazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dichloro-2-methylpyrazolo[3,4-d]pyridazine (CAS 2645374-13-4) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 4,7-dichloro-2-methylpyrazolo[3,4-d]pyridazine. InChIKey: NRJHQKLNXOLPOL-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 4,7-dichloro-2-methylpyrazolo[3,4-d]pyridazine |
| InChIKey | NRJHQKLNXOLPOL-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=N1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)