CAS 2769931-60-2 is the registry number for 2,4-Dichloro-6-methylimidazo[2,1-f][1,2,4]triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6-methylimidazo[2,1-f][1,2,4]triazine (CAS 2769931-60-2) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 2,4-dichloro-6-methylimidazo[2,1-f][1,2,4]triazine. InChIKey: CAYKBZKAUAEOJK-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 2,4-dichloro-6-methylimidazo[2,1-f][1,2,4]triazine |
| InChIKey | CAYKBZKAUAEOJK-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)