CAS 1373519-64-2 is the registry number for 5,7-Dichloro-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 1373519-64-2) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 5,7-dichloro-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: JLQBKJYNOAHPBO-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 5,7-dichloro-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | JLQBKJYNOAHPBO-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=CC(=NC2=N1)Cl)Cl |
Computed by PubChem (NCBI)