CAS 1358805-28-3 is the registry number for 2-(1-(3-(Trifluoromethyl)phenyl)cyclobutyl)acetic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetic acid (CAS 1358805-28-3) is a chemical compound with the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. IUPAC name: 2-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetic acid. InChIKey: OHRLLAYLTYKHEH-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O2 |
|---|---|
| Molecular weight | 258.24 g/mol |
| IUPAC name | 2-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetic acid |
| InChIKey | OHRLLAYLTYKHEH-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CC(=O)O)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)