CAS 2412764-12-4 is the registry number for 2-(4-(Hydroxymethyl)-2-(trifluoromethyl)phenyl)cyclopentan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(hydroxymethyl)-2-(trifluoromethyl)phenyl]cyclopentan-1-one (CAS 2412764-12-4) is a chemical compound with the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. IUPAC name: 2-[4-(hydroxymethyl)-2-(trifluoromethyl)phenyl]cyclopentan-1-one. InChIKey: JKYGMIKMOAWAFO-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O2 |
|---|---|
| Molecular weight | 258.24 g/mol |
| IUPAC name | 2-[4-(hydroxymethyl)-2-(trifluoromethyl)phenyl]cyclopentan-1-one |
| InChIKey | JKYGMIKMOAWAFO-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C1)C2=C(C=C(C=C2)CO)C(F)(F)F |
Computed by PubChem (NCBI)