Products 1439902-85-8

CAS 1439902-85-8 is the registry number for 1-(3-(Trifluoromethyl)benzyl)cyclobutanecarboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-[[3-(trifluoromethyl)phenyl]methyl]cyclobutane-1-carboxylic acid (CAS 1439902-85-8) is a chemical compound with the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. IUPAC name: 1-[[3-(trifluoromethyl)phenyl]methyl]cyclobutane-1-carboxylic acid. InChIKey: HKFJHJJRYWEQFL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13F3O2
Molecular weight258.24 g/mol
IUPAC name1-[[3-(trifluoromethyl)phenyl]methyl]cyclobutane-1-carboxylic acid
InChIKeyHKFJHJJRYWEQFL-UHFFFAOYSA-N
SMILESC1CC(C1)(CC2=CC(=CC=C2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)