CAS 691406-19-6 is the registry number for 3-[3-(trifluoromethyl)benzyl]-2,4-pentanedione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[[3-(trifluoromethyl)phenyl]methyl]pentane-2,4-dione (CAS 691406-19-6) is a chemical compound with the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. IUPAC name: 3-[[3-(trifluoromethyl)phenyl]methyl]pentane-2,4-dione. InChIKey: RSJOPHGHBBOVCE-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O2 |
|---|---|
| Molecular weight | 258.24 g/mol |
| IUPAC name | 3-[[3-(trifluoromethyl)phenyl]methyl]pentane-2,4-dione |
| InChIKey | RSJOPHGHBBOVCE-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CC1=CC(=CC=C1)C(F)(F)F)C(=O)C |
Computed by PubChem (NCBI)