Products 1358805-32-9

CAS 1358805-32-9 is the registry number for 2-{1-(4-(Trifluoromethyl)phenyl)cyclobutyl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[1-[4-(trifluoromethyl)phenyl]cyclobutyl]acetic acid (CAS 1358805-32-9) is a chemical compound with the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. IUPAC name: 2-[1-[4-(trifluoromethyl)phenyl]cyclobutyl]acetic acid. InChIKey: VRBGTLVJSDHVAB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13F3O2
Molecular weight258.24 g/mol
IUPAC name2-[1-[4-(trifluoromethyl)phenyl]cyclobutyl]acetic acid
InChIKeyVRBGTLVJSDHVAB-UHFFFAOYSA-N
SMILESC1CC(C1)(CC(=O)O)C2=CC=C(C=C2)C(F)(F)F

Computed by PubChem (NCBI)