CAS 832738-17-7 appears in our catalog under these names: 4,4,4-Trifluoro-1-(4-(propan-2-yl)phenyl)butane-1,3-dione, 4,4,4-Trifluoro-1-(4-isopropyl-phenyl)-butane-1,3-dione. Offered by: Biosynth, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g.
4,4,4-trifluoro-1-(4-propan-2-ylphenyl)butane-1,3-dione (CAS 832738-17-7) is a chemical compound with the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. IUPAC name: 4,4,4-trifluoro-1-(4-propan-2-ylphenyl)butane-1,3-dione. InChIKey: RBHOXSNQVCLOCL-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O2 |
|---|---|
| Molecular weight | 258.24 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(4-propan-2-ylphenyl)butane-1,3-dione |
| InChIKey | RBHOXSNQVCLOCL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)