Products 878217-65-3

CAS 878217-65-3 appears in our catalog under these names: 1-[3-(Trifluoromethyl)phenyl]cyclopentanecarboxylic acid, 95%, 1-(3-(Trifluoromethyl)phenyl)cyclopentane-1-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxylic acid (CAS 878217-65-3) is a chemical compound with the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxylic acid. InChIKey: APRXSIMKSSZHHM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13F3O2
Molecular weight258.24 g/mol
IUPAC name1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxylic acid
InChIKeyAPRXSIMKSSZHHM-UHFFFAOYSA-N
SMILESC1CCC(C1)(C2=CC(=CC=C2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)