CAS 2228819-43-8 appears in our catalog under these names: 2-{1-[2-(Trifluoromethyl)phenyl]cyclobutyl}acetic acid, 95%, 2-(1-(2-(Trifluoromethyl)phenyl)cyclobutyl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 25mg.
2-[1-[2-(trifluoromethyl)phenyl]cyclobutyl]acetic acid (CAS 2228819-43-8) is a chemical compound with the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. IUPAC name: 2-[1-[2-(trifluoromethyl)phenyl]cyclobutyl]acetic acid. InChIKey: LBUNFKHNSMVMPT-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O2 |
|---|---|
| Molecular weight | 258.24 g/mol |
| IUPAC name | 2-[1-[2-(trifluoromethyl)phenyl]cyclobutyl]acetic acid |
| InChIKey | LBUNFKHNSMVMPT-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CC(=O)O)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)