CAS 1367926-76-8 appears in our catalog under these names: 3-Methyl-4-(trifluoromethyl)-1,2-oxazole-5-carboxylic acid, 95%, 3-Methyl-4-(trifluoromethyl)-1,2-oxazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-methyl-4-(trifluoromethyl)-1,2-oxazole-5-carboxylic acid (CAS 1367926-76-8) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: 3-methyl-4-(trifluoromethyl)-1,2-oxazole-5-carboxylic acid. InChIKey: KFIDQXQBWIKRBW-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO3 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 3-methyl-4-(trifluoromethyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | KFIDQXQBWIKRBW-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)