CAS 499766-90-4 appears in our catalog under these names: 2-Methyl-4-(trifluoromethyl)oxazole-5-carboxylic acid, 97%, 2-Methyl-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
2-methyl-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid (CAS 499766-90-4) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: 2-methyl-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid. InChIKey: MUCHPEWZKWNIEW-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO3 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 2-methyl-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
| InChIKey | MUCHPEWZKWNIEW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)