Products 1779905-44-0

CAS 1779905-44-0 is the registry number for 3-(2,2,2-Trifluoroethyl)isoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2,2,2-trifluoroethyl)-1,2-oxazole-4-carboxylic acid (CAS 1779905-44-0) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: 3-(2,2,2-trifluoroethyl)-1,2-oxazole-4-carboxylic acid. InChIKey: MQIMZRQDZMJVJF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4F3NO3
Molecular weight195.10 g/mol
IUPAC name3-(2,2,2-trifluoroethyl)-1,2-oxazole-4-carboxylic acid
InChIKeyMQIMZRQDZMJVJF-UHFFFAOYSA-N
SMILESC1=C(C(=NO1)CC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)