CAS 2735655-28-2 is the registry number for 4-(2,2,2-Trifluoroethyl)isoxazole-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,2,2-trifluoroethyl)-1,2-oxazole-3-carboxylic acid (CAS 2735655-28-2) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: 4-(2,2,2-trifluoroethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: LCCNUGQPLCEEQG-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO3 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | LCCNUGQPLCEEQG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NO1)C(=O)O)CC(F)(F)F |
Computed by PubChem (NCBI)