CAS 1803603-75-9 appears in our catalog under these names: Methyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate, 95%, Methyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate (CAS 1803603-75-9) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: methyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate. InChIKey: MABXXVJGKJMSSA-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO3 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | methyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate |
| InChIKey | MABXXVJGKJMSSA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(O1)C(F)(F)F |
Computed by PubChem (NCBI)