Products 1936494-76-6

CAS 1936494-76-6 is the registry number for 5-(2,2,2-Trifluoroethyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(2,2,2-trifluoroethyl)-1,2-oxazole-3-carboxylic acid (CAS 1936494-76-6) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: 5-(2,2,2-trifluoroethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: LHNUWAQOQUZWML-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4F3NO3
Molecular weight195.10 g/mol
IUPAC name5-(2,2,2-trifluoroethyl)-1,2-oxazole-3-carboxylic acid
InChIKeyLHNUWAQOQUZWML-UHFFFAOYSA-N
SMILESC1=C(ON=C1C(=O)O)CC(F)(F)F

Computed by PubChem (NCBI)